C30H29NO4 — CID 166449197
tert-butyl (3R,4'R)-4'-ethenyl-2-oxo-2',4'-diphenylspiro[indole-3,3'-oxolane]-1-carboxylate (PubChem CID 166449197) has the molecular formula C30H29NO4 and a molecular weight of 467.57 g/mol. Its IUPAC name is tert-butyl (3R,4'R)-4'-ethenyl-2-oxo-2',4'-diphenylspiro[indole-3,3'-oxolane]-1-carboxylate.
| Compound Name | tert-butyl (3R,4'R)-4'-ethenyl-2-oxo-2',4'-diphenylspiro[indole-3,3'-oxolane]-1-carboxylate |
|---|---|
| PubChem CID | 166449197 |
| Molecular Formula | C30H29NO4 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | tert-butyl (3R,4'R)-4'-ethenyl-2-oxo-2',4'-diphenylspiro[indole-3,3'-oxolane]-1-carboxylate |
| SMILES | C=C[C@]1(c2ccccc2)COC(c2ccccc2)[C@]12C(=O)N(C(=O)OC(C)(C)C)c1ccccc12 |
| InChI | InChI=1S/C30H29NO4/c1-5-29(22-16-10-7-11-17-22)20-34-25(21-14-8-6-9-15-21)30(29)23-18-12-13-19-24(23)31(26(30)32)27(33)35-28(2,3)4/h5-19,25H,1,20H2,2-4H3/t25?,29-,30-/m1/s1 |
| InChIKey | ZKNPVDFUNSXNQX-MJTJDVJOSA-N |
| XLogP | 6.10 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|