C24H42O3Si — CID 134945438
triethyl-[[(11S)-3,3,8,10-tetramethyl-11-[(E)-pent-3-en-2-yl]-2,4-dioxaspiro[5.5]undeca-7,9-dien-9-yl]oxy]silane (PubChem CID 134945438) has the molecular formula C24H42O3Si and a molecular weight of 406.68 g/mol. Its IUPAC name is triethyl-[[(11S)-3,3,8,10-tetramethyl-11-[(E)-pent-3-en-2-yl]-2,4-dioxaspiro[5.5]undeca-7,9-dien-9-yl]oxy]silane.
| Compound Name | triethyl-[[(11S)-3,3,8,10-tetramethyl-11-[(E)-pent-3-en-2-yl]-2,4-dioxaspiro[5.5]undeca-7,9-dien-9-yl]oxy]silane |
|---|---|
| PubChem CID | 134945438 |
| Molecular Formula | C24H42O3Si |
| Molecular Weight | 406.68 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | triethyl-[[(11S)-3,3,8,10-tetramethyl-11-[(E)-pent-3-en-2-yl]-2,4-dioxaspiro[5.5]undeca-7,9-dien-9-yl]oxy]silane |
| SMILES | C/C=C/C(C)[C@@H]1C(C)=C(O[Si](CC)(CC)CC)C(C)=CC12COC(C)(C)OC2 |
| InChI | InChI=1S/C24H42O3Si/c1-10-14-18(5)21-20(7)22(27-28(11-2,12-3)13-4)19(6)15-24(21)16-25-23(8,9)26-17-24/h10,14-15,18,21H,11-13,16-17H2,1-9H3/b14-10+/t18?,21-/m1/s1 |
| InChIKey | AKVXPBSDTSTSDY-LSVUBSAJSA-N |
| XLogP | 6.84 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.68 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|