C17H24O3 — CID 134945504
(1R)-2-[(2S,4S)-2-cyclohexyl-1,3-dioxolan-4-yl]-1-phenylethanol (PubChem CID 134945504) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (1R)-2-[(2S,4S)-2-cyclohexyl-1,3-dioxolan-4-yl]-1-phenylethanol.
| Compound Name | (1R)-2-[(2S,4S)-2-cyclohexyl-1,3-dioxolan-4-yl]-1-phenylethanol |
|---|---|
| PubChem CID | 134945504 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (1R)-2-[(2S,4S)-2-cyclohexyl-1,3-dioxolan-4-yl]-1-phenylethanol |
| SMILES | O[C@H](C[C@H]1CO[C@H](C2CCCCC2)O1)c1ccccc1 |
| InChI | InChI=1S/C17H24O3/c18-16(13-7-3-1-4-8-13)11-15-12-19-17(20-15)14-9-5-2-6-10-14/h1,3-4,7-8,14-18H,2,5-6,9-12H2/t15-,16+,17-/m0/s1 |
| InChIKey | NOPKYXQIIFTLHT-BBWFWOEESA-N |
| XLogP | 3.43 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |