C24H34O4 — CID 134945589
4-methoxy-5-methylidene-3-[(2E,4R,6R,10E)-2,4,6,12-tetramethyltetradeca-2,10,12-trienoyl]furan-2-one (PubChem CID 134945589) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is 4-methoxy-5-methylidene-3-[(2E,4R,6R,10E)-2,4,6,12-tetramethyltetradeca-2,10,12-trienoyl]furan-2-one.
| Compound Name | 4-methoxy-5-methylidene-3-[(2E,4R,6R,10E)-2,4,6,12-tetramethyltetradeca-2,10,12-trienoyl]furan-2-one |
|---|---|
| PubChem CID | 134945589 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 4-methoxy-5-methylidene-3-[(2E,4R,6R,10E)-2,4,6,12-tetramethyltetradeca-2,10,12-trienoyl]furan-2-one |
| SMILES | C=C1OC(=O)C(C(=O)/C(C)=C/[C@H](C)C[C@H](C)CCC/C=C/C(C)=CC)=C1OC |
| InChI | InChI=1S/C24H34O4/c1-8-16(2)12-10-9-11-13-17(3)14-18(4)15-19(5)22(25)21-23(27-7)20(6)28-24(21)26/h8,10,12,15,17-18H,6,9,11,13-14H2,1-5,7H3/b12-10+,16-8?,19-15+/t17-,18-/m1/s1 |
| InChIKey | JGUCFRHPJDXZRE-JCKVEELRSA-N |
| XLogP | 5.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|