C19H21O5- — CID 155903263
4-[(2R,4S,6E,8E,10E)-2,4-dimethyl-5-oxododeca-6,8,10-trienoyl]-2-methylidene-5-oxofuran-3-olate (PubChem CID 155903263) has the molecular formula C19H21O5- and a molecular weight of 329.37 g/mol. Its IUPAC name is 4-[(2R,4S,6E,8E,10E)-2,4-dimethyl-5-oxododeca-6,8,10-trienoyl]-2-methylidene-5-oxofuran-3-olate.
| Compound Name | 4-[(2R,4S,6E,8E,10E)-2,4-dimethyl-5-oxododeca-6,8,10-trienoyl]-2-methylidene-5-oxofuran-3-olate |
|---|---|
| PubChem CID | 155903263 |
| Molecular Formula | C19H21O5- |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 4-[(2R,4S,6E,8E,10E)-2,4-dimethyl-5-oxododeca-6,8,10-trienoyl]-2-methylidene-5-oxofuran-3-olate |
| SMILES | C=C1OC(=O)C(C(=O)[C@H](C)C[C@H](C)C(=O)/C=C/C=C/C=C/C)=C1[O-] |
| InChI | InChI=1S/C19H22O5/c1-5-6-7-8-9-10-15(20)12(2)11-13(3)17(21)16-18(22)14(4)24-19(16)23/h5-10,12-13,22H,4,11H2,1-3H3/p-1/b6-5+,8-7+,10-9+/t12-,13+/m0/s1 |
| InChIKey | IHDUVTNKEYLVTO-NLJBVMSWSA-M |
| XLogP | 2.16 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|