C26H40O6Si — CID 11712644
(2R,4S,8E,10E)-7-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxy-5-methylidene-2-oxofuran-3-yl)-2,4-dimethyldodeca-8,10-diene-1,5-dione (PubChem CID 11712644) has the molecular formula C26H40O6Si and a molecular weight of 476.69 g/mol. Its IUPAC name is (2R,4S,8E,10E)-7-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxy-5-methylidene-2-oxofuran-3-yl)-2,4-dimethyldodeca-8,10-diene-1,5-dione.
| Compound Name | (2R,4S,8E,10E)-7-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxy-5-methylidene-2-oxofuran-3-yl)-2,4-dimethyldodeca-8,10-diene-1,5-dione |
|---|---|
| PubChem CID | 11712644 |
| Molecular Formula | C26H40O6Si |
| Molecular Weight | 476.69 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | (2R,4S,8E,10E)-7-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxy-5-methylidene-2-oxofuran-3-yl)-2,4-dimethyldodeca-8,10-diene-1,5-dione |
| SMILES | C=C1OC(=O)C(C(=O)[C@H](C)C[C@H](C)C(=O)CC(/C=C/C=C/C)O[Si](C)(C)C(C)(C)C)=C1OC |
| InChI | InChI=1S/C26H40O6Si/c1-11-12-13-14-20(32-33(9,10)26(5,6)7)16-21(27)17(2)15-18(3)23(28)22-24(30-8)19(4)31-25(22)29/h11-14,17-18,20H,4,15-16H2,1-3,5-10H3/b12-11+,14-13+/t17-,18+,20?/m0/s1 |
| InChIKey | GRAFQPMZVDYWPC-MNMVLAQXSA-N |
| XLogP | 5.67 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.69 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|