C17H28O4Si — CID 10314201
methyl 2-[(1R,3S)-3-methyl-1-trimethylsilyloxyhex-5-enyl]-5-oxocyclopentene-1-carboxylate (PubChem CID 10314201) has the molecular formula C17H28O4Si and a molecular weight of 324.49 g/mol. Its IUPAC name is methyl 2-[(1R,3S)-3-methyl-1-trimethylsilyloxyhex-5-enyl]-5-oxocyclopentene-1-carboxylate.
| Compound Name | methyl 2-[(1R,3S)-3-methyl-1-trimethylsilyloxyhex-5-enyl]-5-oxocyclopentene-1-carboxylate |
|---|---|
| PubChem CID | 10314201 |
| Molecular Formula | C17H28O4Si |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | methyl 2-[(1R,3S)-3-methyl-1-trimethylsilyloxyhex-5-enyl]-5-oxocyclopentene-1-carboxylate |
| SMILES | C=CC[C@H](C)C[C@@H](O[Si](C)(C)C)C1=C(C(=O)OC)C(=O)CC1 |
| InChI | InChI=1S/C17H28O4Si/c1-7-8-12(2)11-15(21-22(4,5)6)13-9-10-14(18)16(13)17(19)20-3/h7,12,15H,1,8-11H2,2-6H3/t12-,15+/m0/s1 |
| InChIKey | PVYYPSMLHQHNBR-SWLSCSKDSA-N |
| XLogP | 3.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|