C9H14F2 — CID 134945748
[(E)-3,3-difluoroprop-1-enyl]cyclohexane (PubChem CID 134945748) has the molecular formula C9H14F2 and a molecular weight of 160.21 g/mol. Its IUPAC name is [(E)-3,3-difluoroprop-1-enyl]cyclohexane.
| Compound Name | [(E)-3,3-difluoroprop-1-enyl]cyclohexane |
|---|---|
| PubChem CID | 134945748 |
| Molecular Formula | C9H14F2 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | [(E)-3,3-difluoroprop-1-enyl]cyclohexane |
| SMILES | FC(F)/C=C/C1CCCCC1 |
| InChI | InChI=1S/C9H14F2/c10-9(11)7-6-8-4-2-1-3-5-8/h6-9H,1-5H2/b7-6+ |
| InChIKey | JSCIJBSPCGOWCZ-VOTSOKGWSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|