C18H24O3 — CID 134945832
cis-(2R,4S)-4-butyl-2-methyl-2-(phenylmethoxymethyl)cyclopentane-1,3-dione (PubChem CID 134945832) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is cis-(2R,4S)-4-butyl-2-methyl-2-(phenylmethoxymethyl)cyclopentane-1,3-dione.
| Compound Name | cis-(2R,4S)-4-butyl-2-methyl-2-(phenylmethoxymethyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 134945832 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | cis-(2R,4S)-4-butyl-2-methyl-2-(phenylmethoxymethyl)cyclopentane-1,3-dione |
| SMILES | CCCC[C@H]1CC(=O)[C@@](C)(COCc2ccccc2)C1=O |
| InChI | InChI=1S/C18H24O3/c1-3-4-10-15-11-16(19)18(2,17(15)20)13-21-12-14-8-6-5-7-9-14/h5-9,15H,3-4,10-13H2,1-2H3/t15-,18+/m0/s1 |
| InChIKey | JGJMUICHRNQRBV-MAUKXSAKSA-N |
| XLogP | 3.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|