C10H18N2O2+2 — CID 134945833
1-(4-acetyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)ethanone (PubChem CID 134945833) has the molecular formula C10H18N2O2+2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 1-(4-acetyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)ethanone.
| Compound Name | 1-(4-acetyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)ethanone |
|---|---|
| PubChem CID | 134945833 |
| Molecular Formula | C10H18N2O2+2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 1-(4-acetyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)ethanone |
| SMILES | CC(=O)[N+]12CC[N+](C(C)=O)(CC1)CC2 |
| InChI | InChI=1S/C10H18N2O2/c1-9(13)11-3-6-12(7-4-11,8-5-11)10(2)14/h3-8H2,1-2H3/q+2 |
| InChIKey | AAXXFOMIRHCFFX-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|