C11H23N3O+2 — CID 20676164
N,N-dimethyl-2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide (PubChem CID 20676164) has the molecular formula C11H23N3O+2 and a molecular weight of 213.32 g/mol. Its IUPAC name is N,N-dimethyl-2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide.
| Compound Name | N,N-dimethyl-2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide |
|---|---|
| PubChem CID | 20676164 |
| Molecular Formula | C11H23N3O+2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | N,N-dimethyl-2-(4-methyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)acetamide |
| SMILES | CN(C)C(=O)C[N+]12CC[N+](C)(CC1)CC2 |
| InChI | InChI=1S/C11H23N3O/c1-12(2)11(15)10-14-7-4-13(3,5-8-14)6-9-14/h4-10H2,1-3H3/q+2 |
| InChIKey | ZVXGEGCYBITFDL-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|