C22H20Cl2N2O3 — CID 134946338
tert-butyl (NE)-N-[1-[(E)-3-(3,4-dichlorophenyl)prop-2-enyl]-2-oxoindol-3-ylidene]carbamate (PubChem CID 134946338) has the molecular formula C22H20Cl2N2O3 and a molecular weight of 431.32 g/mol. Its IUPAC name is tert-butyl (NE)-N-[1-[(E)-3-(3,4-dichlorophenyl)prop-2-enyl]-2-oxoindol-3-ylidene]carbamate.
| Compound Name | tert-butyl (NE)-N-[1-[(E)-3-(3,4-dichlorophenyl)prop-2-enyl]-2-oxoindol-3-ylidene]carbamate |
|---|---|
| PubChem CID | 134946338 |
| Molecular Formula | C22H20Cl2N2O3 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | tert-butyl (NE)-N-[1-[(E)-3-(3,4-dichlorophenyl)prop-2-enyl]-2-oxoindol-3-ylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)/N=C1/C(=O)N(C/C=C/c2ccc(Cl)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C22H20Cl2N2O3/c1-22(2,3)29-21(28)25-19-15-8-4-5-9-18(15)26(20(19)27)12-6-7-14-10-11-16(23)17(24)13-14/h4-11,13H,12H2,1-3H3/b7-6+,25-19+ |
| InChIKey | NJQOUMYTWZVTNX-IIEBANRSSA-N |
| XLogP | 5.78 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|