C17H11Cl2IN2O3 — CID 52940990
[(E)-[1-[(3,4-dichlorophenyl)methyl]-5-iodo-2-oxoindol-3-ylidene]amino] acetate (PubChem CID 52940990) has the molecular formula C17H11Cl2IN2O3 and a molecular weight of 489.10 g/mol. Its IUPAC name is [(E)-[1-[(3,4-dichlorophenyl)methyl]-5-iodo-2-oxoindol-3-ylidene]amino] acetate.
| Compound Name | [(E)-[1-[(3,4-dichlorophenyl)methyl]-5-iodo-2-oxoindol-3-ylidene]amino] acetate |
|---|---|
| PubChem CID | 52940990 |
| Molecular Formula | C17H11Cl2IN2O3 |
| Molecular Weight | 489.10 g/mol |
| Exact Mass | 487.92 |
| IUPAC Name | [(E)-[1-[(3,4-dichlorophenyl)methyl]-5-iodo-2-oxoindol-3-ylidene]amino] acetate |
| SMILES | CC(=O)O/N=C1/C(=O)N(Cc2ccc(Cl)c(Cl)c2)c2ccc(I)cc21 |
| InChI | InChI=1S/C17H11Cl2IN2O3/c1-9(23)25-21-16-12-7-11(20)3-5-15(12)22(17(16)24)8-10-2-4-13(18)14(19)6-10/h2-7H,8H2,1H3/b21-16+ |
| InChIKey | ULBHZOSESWZSMP-LTGZKZEYSA-N |
| XLogP | 4.41 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.10 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|