C10H17FO — CID 134946576
(4R)-4-(2-fluoropropan-2-yl)-1-methyl-7-oxabicyclo[4.1.0]heptane (PubChem CID 134946576) has the molecular formula C10H17FO and a molecular weight of 172.24 g/mol. Its IUPAC name is (4R)-4-(2-fluoropropan-2-yl)-1-methyl-7-oxabicyclo[4.1.0]heptane.
| Compound Name | (4R)-4-(2-fluoropropan-2-yl)-1-methyl-7-oxabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 134946576 |
| Molecular Formula | C10H17FO |
| Molecular Weight | 172.24 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | (4R)-4-(2-fluoropropan-2-yl)-1-methyl-7-oxabicyclo[4.1.0]heptane |
| SMILES | CC12CC[C@@H](C(C)(C)F)CC1O2 |
| InChI | InChI=1S/C10H17FO/c1-9(2,11)7-4-5-10(3)8(6-7)12-10/h7-8H,4-6H2,1-3H3/t7-,8?,10?/m1/s1 |
| InChIKey | TZSFXVZCIDRSQP-ZNFPMYQNSA-N |
| XLogP | 2.69 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|