C19H16F3NO — CID 134946604
(3R)-4,4,4-trifluoro-3-(1-methylindol-3-yl)-1-phenylbutan-1-one (PubChem CID 134946604) has the molecular formula C19H16F3NO and a molecular weight of 331.34 g/mol. Its IUPAC name is (3R)-4,4,4-trifluoro-3-(1-methylindol-3-yl)-1-phenylbutan-1-one.
| Compound Name | (3R)-4,4,4-trifluoro-3-(1-methylindol-3-yl)-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 134946604 |
| Molecular Formula | C19H16F3NO |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | (3R)-4,4,4-trifluoro-3-(1-methylindol-3-yl)-1-phenylbutan-1-one |
| SMILES | Cn1cc([C@@H](CC(=O)c2ccccc2)C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C19H16F3NO/c1-23-12-15(14-9-5-6-10-17(14)23)16(19(20,21)22)11-18(24)13-7-3-2-4-8-13/h2-10,12,16H,11H2,1H3/t16-/m1/s1 |
| InChIKey | YOQWKDMJCGFVMH-MRXNPFEDSA-N |
| XLogP | 5.10 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |