C21H28F3NO3 — CID 134947198
tert-butyl N-[(E,2R)-1,1,1-trifluoro-3-oxo-2-phenyldec-4-en-2-yl]carbamate (PubChem CID 134947198) has the molecular formula C21H28F3NO3 and a molecular weight of 399.45 g/mol. Its IUPAC name is tert-butyl N-[(E,2R)-1,1,1-trifluoro-3-oxo-2-phenyldec-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(E,2R)-1,1,1-trifluoro-3-oxo-2-phenyldec-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 134947198 |
| Molecular Formula | C21H28F3NO3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | tert-butyl N-[(E,2R)-1,1,1-trifluoro-3-oxo-2-phenyldec-4-en-2-yl]carbamate |
| SMILES | CCCCC/C=C/C(=O)[C@](NC(=O)OC(C)(C)C)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C21H28F3NO3/c1-5-6-7-8-12-15-17(26)20(21(22,23)24,16-13-10-9-11-14-16)25-18(27)28-19(2,3)4/h9-15H,5-8H2,1-4H3,(H,25,27)/b15-12+/t20-/m1/s1 |
| InChIKey | AIQVEPWTGPJZHG-IZLCOFNUSA-N |
| XLogP | 5.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|