C22H38O6Si — CID 134947242
[(1aR,3R,4S,4aR,7R,7aR,7bS)-1a-acetyl-4-hydroxy-4,7-dimethyl-2,3,4a,5,6,7,7a,7b-octahydroazuleno[4,5-b]oxiren-3-yl] 2-[tert-butyl(dimethyl)silyl]oxyacetate (PubChem CID 134947242) has the molecular formula C22H38O6Si and a molecular weight of 426.63 g/mol. Its IUPAC name is [(1aR,3R,4S,4aR,7R,7aR,7bS)-1a-acetyl-4-hydroxy-4,7-dimethyl-2,3,4a,5,6,7,7a,7b-octahydroazuleno[4,5-b]oxiren-3-yl] 2-[tert-butyl(dimethyl)silyl]oxyacetate.
| Compound Name | [(1aR,3R,4S,4aR,7R,7aR,7bS)-1a-acetyl-4-hydroxy-4,7-dimethyl-2,3,4a,5,6,7,7a,7b-octahydroazuleno[4,5-b]oxiren-3-yl] 2-[tert-butyl(dimethyl)silyl]oxyacetate |
|---|---|
| PubChem CID | 134947242 |
| Molecular Formula | C22H38O6Si |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | [(1aR,3R,4S,4aR,7R,7aR,7bS)-1a-acetyl-4-hydroxy-4,7-dimethyl-2,3,4a,5,6,7,7a,7b-octahydroazuleno[4,5-b]oxiren-3-yl] 2-[tert-butyl(dimethyl)silyl]oxyacetate |
| SMILES | CC(=O)[C@@]12C[C@@H](OC(=O)CO[Si](C)(C)C(C)(C)C)[C@@](C)(O)[C@@H]3CC[C@@H](C)[C@H]3[C@@H]1O2 |
| InChI | InChI=1S/C22H38O6Si/c1-13-9-10-15-18(13)19-22(28-19,14(2)23)11-16(21(15,6)25)27-17(24)12-26-29(7,8)20(3,4)5/h13,15-16,18-19,25H,9-12H2,1-8H3/t13-,15-,16-,18-,19+,21+,22+/m1/s1 |
| InChIKey | YEWOALQOSTVUON-GUYPCVNOSA-N |
| XLogP | 3.46 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|