C22H24O4S — CID 134947357
tert-butyl (2R,3S,4R)-2-(2-oxoethyl)-4-phenyl-3-thiophen-2-yl-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 134947357) has the molecular formula C22H24O4S and a molecular weight of 384.50 g/mol. Its IUPAC name is tert-butyl (2R,3S,4R)-2-(2-oxoethyl)-4-phenyl-3-thiophen-2-yl-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | tert-butyl (2R,3S,4R)-2-(2-oxoethyl)-4-phenyl-3-thiophen-2-yl-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 134947357 |
| Molecular Formula | C22H24O4S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | tert-butyl (2R,3S,4R)-2-(2-oxoethyl)-4-phenyl-3-thiophen-2-yl-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1=C[C@@H](c2ccccc2)[C@H](c2cccs2)[C@@H](CC=O)O1 |
| InChI | InChI=1S/C22H24O4S/c1-22(2,3)26-21(24)18-14-16(15-8-5-4-6-9-15)20(17(25-18)11-12-23)19-10-7-13-27-19/h4-10,12-14,16-17,20H,11H2,1-3H3/t16-,17+,20-/m0/s1 |
| InChIKey | VXUNUWHWWGUCDF-QKLQHJQFSA-N |
| XLogP | 4.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|