C18H20O4S — CID 134947409
ethyl (2S,4R,6R)-4-hydroxy-4-phenyl-6-thiophen-2-yloxane-2-carboxylate (PubChem CID 134947409) has the molecular formula C18H20O4S and a molecular weight of 332.42 g/mol. Its IUPAC name is ethyl (2S,4R,6R)-4-hydroxy-4-phenyl-6-thiophen-2-yloxane-2-carboxylate.
| Compound Name | ethyl (2S,4R,6R)-4-hydroxy-4-phenyl-6-thiophen-2-yloxane-2-carboxylate |
|---|---|
| PubChem CID | 134947409 |
| Molecular Formula | C18H20O4S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | ethyl (2S,4R,6R)-4-hydroxy-4-phenyl-6-thiophen-2-yloxane-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@](O)(c2ccccc2)C[C@H](c2cccs2)O1 |
| InChI | InChI=1S/C18H20O4S/c1-2-21-17(19)15-12-18(20,13-7-4-3-5-8-13)11-14(22-15)16-9-6-10-23-16/h3-10,14-15,20H,2,11-12H2,1H3/t14-,15+,18+/m1/s1 |
| InChIKey | LBAFJCCVIVUXTF-VKJFTORMSA-N |
| XLogP | 3.42 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |