C22H25F3O3S — CID 57240544
3-[2-(8-thiophen-2-yloctyl)-3-(trifluoromethyl)phenyl]oxirane-2-carboxylic acid (PubChem CID 57240544) has the molecular formula C22H25F3O3S and a molecular weight of 426.50 g/mol. Its IUPAC name is 3-[2-(8-thiophen-2-yloctyl)-3-(trifluoromethyl)phenyl]oxirane-2-carboxylic acid.
| Compound Name | 3-[2-(8-thiophen-2-yloctyl)-3-(trifluoromethyl)phenyl]oxirane-2-carboxylic acid |
|---|---|
| PubChem CID | 57240544 |
| Molecular Formula | C22H25F3O3S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 3-[2-(8-thiophen-2-yloctyl)-3-(trifluoromethyl)phenyl]oxirane-2-carboxylic acid |
| SMILES | O=C(O)C1OC1c1cccc(C(F)(F)F)c1CCCCCCCCc1cccs1 |
| InChI | InChI=1S/C22H25F3O3S/c23-22(24,25)18-13-7-12-17(19-20(28-19)21(26)27)16(18)11-6-4-2-1-3-5-9-15-10-8-14-29-15/h7-8,10,12-14,19-20H,1-6,9,11H2,(H,26,27) |
| InChIKey | WHOCHAZIPOCRSA-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|