C22H17NO2 — CID 134947529
N-(2,3-diphenyl-1-benzofuran-5-yl)acetamide (PubChem CID 134947529) has the molecular formula C22H17NO2 and a molecular weight of 327.38 g/mol. Its IUPAC name is N-(2,3-diphenyl-1-benzofuran-5-yl)acetamide.
| Compound Name | N-(2,3-diphenyl-1-benzofuran-5-yl)acetamide |
|---|---|
| PubChem CID | 134947529 |
| Molecular Formula | C22H17NO2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | N-(2,3-diphenyl-1-benzofuran-5-yl)acetamide |
| SMILES | CC(=O)Nc1ccc2oc(-c3ccccc3)c(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C22H17NO2/c1-15(24)23-18-12-13-20-19(14-18)21(16-8-4-2-5-9-16)22(25-20)17-10-6-3-7-11-17/h2-14H,1H3,(H,23,24) |
| InChIKey | FPKXTLXFPKFRBZ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |