C18H33NO4 — CID 134947538
tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[(Z)-oct-3-enyl]carbamate (PubChem CID 134947538) has the molecular formula C18H33NO4 and a molecular weight of 327.47 g/mol. Its IUPAC name is tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[(Z)-oct-3-enyl]carbamate.
| Compound Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[(Z)-oct-3-enyl]carbamate |
|---|---|
| PubChem CID | 134947538 |
| Molecular Formula | C18H33NO4 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[(Z)-oct-3-enyl]carbamate |
| SMILES | CCCC/C=C\CCN(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H33NO4/c1-8-9-10-11-12-13-14-19(15(20)22-17(2,3)4)16(21)23-18(5,6)7/h11-12H,8-10,13-14H2,1-7H3/b12-11- |
| InChIKey | GCGDEKQKMUNUMQ-QXMHVHEDSA-N |
| XLogP | 5.30 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|