C22H34N2O6 — CID 139181477
ditert-butyl (5E,12E)-2,9-dioxo-1,8-diazacyclotetradeca-5,12-diene-1,8-dicarboxylate (PubChem CID 139181477) has the molecular formula C22H34N2O6 and a molecular weight of 422.52 g/mol. Its IUPAC name is ditert-butyl (5E,12E)-2,9-dioxo-1,8-diazacyclotetradeca-5,12-diene-1,8-dicarboxylate.
| Compound Name | ditert-butyl (5E,12E)-2,9-dioxo-1,8-diazacyclotetradeca-5,12-diene-1,8-dicarboxylate |
|---|---|
| PubChem CID | 139181477 |
| Molecular Formula | C22H34N2O6 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | ditert-butyl (5E,12E)-2,9-dioxo-1,8-diazacyclotetradeca-5,12-diene-1,8-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1C/C=C/CCC(=O)N(C(=O)OC(C)(C)C)C/C=C/CCC1=O |
| InChI | InChI=1S/C22H34N2O6/c1-21(2,3)29-19(27)23-15-11-7-10-14-18(26)24(20(28)30-22(4,5)6)16-12-8-9-13-17(23)25/h7-8,11-12H,9-10,13-16H2,1-6H3/b11-7+,12-8+ |
| InChIKey | BITBISGRXIXGTP-MKICQXMISA-N |
| XLogP | 4.20 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|