C14H17F3O6S — CID 134947644
[3,3,3-trifluoro-1-[2-(4-methylphenyl)sulfonyloxyethoxy]propyl] acetate (PubChem CID 134947644) has the molecular formula C14H17F3O6S and a molecular weight of 370.35 g/mol. Its IUPAC name is [3,3,3-trifluoro-1-[2-(4-methylphenyl)sulfonyloxyethoxy]propyl] acetate.
| Compound Name | [3,3,3-trifluoro-1-[2-(4-methylphenyl)sulfonyloxyethoxy]propyl] acetate |
|---|---|
| PubChem CID | 134947644 |
| Molecular Formula | C14H17F3O6S |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | [3,3,3-trifluoro-1-[2-(4-methylphenyl)sulfonyloxyethoxy]propyl] acetate |
| SMILES | CC(=O)OC(CC(F)(F)F)OCCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H17F3O6S/c1-10-3-5-12(6-4-10)24(19,20)22-8-7-21-13(23-11(2)18)9-14(15,16)17/h3-6,13H,7-9H2,1-2H3 |
| InChIKey | FXLXDYPHGJHFKD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|