C20H20N2 — CID 134947669
(3R,4'R)-1'-benzyl-4'-ethenylspiro[indole-3,3'-pyrrolidine] (PubChem CID 134947669) has the molecular formula C20H20N2 and a molecular weight of 288.39 g/mol. Its IUPAC name is (3R,4'R)-1'-benzyl-4'-ethenylspiro[indole-3,3'-pyrrolidine].
| Compound Name | (3R,4'R)-1'-benzyl-4'-ethenylspiro[indole-3,3'-pyrrolidine] |
|---|---|
| PubChem CID | 134947669 |
| Molecular Formula | C20H20N2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | (3R,4'R)-1'-benzyl-4'-ethenylspiro[indole-3,3'-pyrrolidine] |
| SMILES | C=C[C@H]1CN(Cc2ccccc2)C[C@@]12C=Nc1ccccc12 |
| InChI | InChI=1S/C20H20N2/c1-2-17-13-22(12-16-8-4-3-5-9-16)15-20(17)14-21-19-11-7-6-10-18(19)20/h2-11,14,17H,1,12-13,15H2/t17-,20-/m0/s1 |
| InChIKey | UYVSORXTPJZUMZ-PXNSSMCTSA-N |
| XLogP | 3.96 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|