C14H12BrN3O3 — CID 134947691
methyl 1-[(E)-(4-bromophenyl)methylideneamino]-5-carbamoylpyrrole-3-carboxylate (PubChem CID 134947691) has the molecular formula C14H12BrN3O3 and a molecular weight of 350.17 g/mol. Its IUPAC name is methyl 1-[(E)-(4-bromophenyl)methylideneamino]-5-carbamoylpyrrole-3-carboxylate.
| Compound Name | methyl 1-[(E)-(4-bromophenyl)methylideneamino]-5-carbamoylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 134947691 |
| Molecular Formula | C14H12BrN3O3 |
| Molecular Weight | 350.17 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | methyl 1-[(E)-(4-bromophenyl)methylideneamino]-5-carbamoylpyrrole-3-carboxylate |
| SMILES | COC(=O)c1cc(C(N)=O)n(/N=C/c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C14H12BrN3O3/c1-21-14(20)10-6-12(13(16)19)18(8-10)17-7-9-2-4-11(15)5-3-9/h2-8H,1H3,(H2,16,19)/b17-7+ |
| InChIKey | LTFXECDZAMDGMW-REZTVBANSA-N |
| XLogP | 2.02 |
| TPSA | 86.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.17 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|