C18H21NO9S — CID 134948142
3-O-ethyl 2-O,2-O'-dimethyl (3R)-1-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2,2,3-tricarboxylate (PubChem CID 134948142) has the molecular formula C18H21NO9S and a molecular weight of 427.43 g/mol. Its IUPAC name is 3-O-ethyl 2-O,2-O'-dimethyl (3R)-1-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2,2,3-tricarboxylate.
| Compound Name | 3-O-ethyl 2-O,2-O'-dimethyl (3R)-1-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2,2,3-tricarboxylate |
|---|---|
| PubChem CID | 134948142 |
| Molecular Formula | C18H21NO9S |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 3-O-ethyl 2-O,2-O'-dimethyl (3R)-1-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2,2,3-tricarboxylate |
| SMILES | CCOC(=O)[C@@H]1CC(=O)N(S(=O)(=O)c2ccc(C)cc2)C1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C18H21NO9S/c1-5-28-15(21)13-10-14(20)19(18(13,16(22)26-3)17(23)27-4)29(24,25)12-8-6-11(2)7-9-12/h6-9,13H,5,10H2,1-4H3/t13-/m0/s1 |
| InChIKey | LEJIJBAXLUUHCK-ZDUSSCGKSA-N |
| XLogP | 0.18 |
| TPSA | 133.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|