C15H16F3NO5S — CID 56840316
ethyl (2S)-1-(4-methylphenyl)sulfonyl-5-oxo-2-(trifluoromethyl)pyrrolidine-2-carboxylate (PubChem CID 56840316) has the molecular formula C15H16F3NO5S and a molecular weight of 379.36 g/mol. Its IUPAC name is ethyl (2S)-1-(4-methylphenyl)sulfonyl-5-oxo-2-(trifluoromethyl)pyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S)-1-(4-methylphenyl)sulfonyl-5-oxo-2-(trifluoromethyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 56840316 |
| Molecular Formula | C15H16F3NO5S |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | ethyl (2S)-1-(4-methylphenyl)sulfonyl-5-oxo-2-(trifluoromethyl)pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@]1(C(F)(F)F)CCC(=O)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H16F3NO5S/c1-3-24-13(21)14(15(16,17)18)9-8-12(20)19(14)25(22,23)11-6-4-10(2)5-7-11/h4-7H,3,8-9H2,1-2H3/t14-/m0/s1 |
| InChIKey | LTGHJKIZSFOJAC-AWEZNQCLSA-N |
| XLogP | 2.17 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |