C26H32O3S — CID 134948749
(3S,4R,7S,8R,11S)-10-(benzenesulfinylmethyl)-3-[(E)-but-2-en-2-yl]-4,6,8,11-tetramethyl-2-oxatricyclo[5.3.1.04,11]undeca-5,9-diene-8-carbaldehyde (PubChem CID 134948749) has the molecular formula C26H32O3S and a molecular weight of 424.61 g/mol. Its IUPAC name is (3S,4R,7S,8R,11S)-10-(benzenesulfinylmethyl)-3-[(E)-but-2-en-2-yl]-4,6,8,11-tetramethyl-2-oxatricyclo[5.3.1.04,11]undeca-5,9-diene-8-carbaldehyde.
| Compound Name | (3S,4R,7S,8R,11S)-10-(benzenesulfinylmethyl)-3-[(E)-but-2-en-2-yl]-4,6,8,11-tetramethyl-2-oxatricyclo[5.3.1.04,11]undeca-5,9-diene-8-carbaldehyde |
|---|---|
| PubChem CID | 134948749 |
| Molecular Formula | C26H32O3S |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | (3S,4R,7S,8R,11S)-10-(benzenesulfinylmethyl)-3-[(E)-but-2-en-2-yl]-4,6,8,11-tetramethyl-2-oxatricyclo[5.3.1.04,11]undeca-5,9-diene-8-carbaldehyde |
| SMILES | C/C=C(\C)[C@@H]1OC2C(CS(=O)c3ccccc3)=C[C@@](C)(C=O)[C@H]3C(C)=C[C@]1(C)[C@@]23C |
| InChI | InChI=1S/C26H32O3S/c1-7-17(2)22-25(5)13-18(3)21-24(4,16-27)14-19(23(29-22)26(21,25)6)15-30(28)20-11-9-8-10-12-20/h7-14,16,21-23H,15H2,1-6H3/b17-7+/t21-,22+,23?,24+,25+,26-,30?/m1/s1 |
| InChIKey | FDGJGTBCNSVZNE-INZUIXSESA-N |
| XLogP | 5.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|