C21H26O3S — CID 10618405
(1R,2S,6R,7R)-9-(benzenesulfinylmethyl)-1,4,4-trimethyl-11-oxatricyclo[5.3.1.02,6]undec-8-ene-8-carbaldehyde (PubChem CID 10618405) has the molecular formula C21H26O3S and a molecular weight of 358.50 g/mol. Its IUPAC name is (1R,2S,6R,7R)-9-(benzenesulfinylmethyl)-1,4,4-trimethyl-11-oxatricyclo[5.3.1.02,6]undec-8-ene-8-carbaldehyde.
| Compound Name | (1R,2S,6R,7R)-9-(benzenesulfinylmethyl)-1,4,4-trimethyl-11-oxatricyclo[5.3.1.02,6]undec-8-ene-8-carbaldehyde |
|---|---|
| PubChem CID | 10618405 |
| Molecular Formula | C21H26O3S |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | (1R,2S,6R,7R)-9-(benzenesulfinylmethyl)-1,4,4-trimethyl-11-oxatricyclo[5.3.1.02,6]undec-8-ene-8-carbaldehyde |
| SMILES | CC1(C)C[C@H]2[C@H]3O[C@](C)(CC(CS(=O)c4ccccc4)=C3C=O)[C@H]2C1 |
| InChI | InChI=1S/C21H26O3S/c1-20(2)10-16-18(11-20)21(3)9-14(17(12-22)19(16)24-21)13-25(23)15-7-5-4-6-8-15/h4-8,12,16,18-19H,9-11,13H2,1-3H3/t16-,18+,19-,21-,25?/m1/s1 |
| InChIKey | XHERWPULODNVQZ-BGFRPKRDSA-N |
| XLogP | 3.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|