C22H28O5S — CID 95565131
ethyl (3aR,4R)-4-[3-(benzenesulfonyl)propyl]-5,5-dimethyl-2-oxo-3,3a,4,6-tetrahydropentalene-1-carboxylate (PubChem CID 95565131) has the molecular formula C22H28O5S and a molecular weight of 404.53 g/mol. Its IUPAC name is ethyl (3aR,4R)-4-[3-(benzenesulfonyl)propyl]-5,5-dimethyl-2-oxo-3,3a,4,6-tetrahydropentalene-1-carboxylate.
| Compound Name | ethyl (3aR,4R)-4-[3-(benzenesulfonyl)propyl]-5,5-dimethyl-2-oxo-3,3a,4,6-tetrahydropentalene-1-carboxylate |
|---|---|
| PubChem CID | 95565131 |
| Molecular Formula | C22H28O5S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | ethyl (3aR,4R)-4-[3-(benzenesulfonyl)propyl]-5,5-dimethyl-2-oxo-3,3a,4,6-tetrahydropentalene-1-carboxylate |
| SMILES | CCOC(=O)C1=C2CC(C)(C)[C@H](CCCS(=O)(=O)c3ccccc3)[C@H]2CC1=O |
| InChI | InChI=1S/C22H28O5S/c1-4-27-21(24)20-17-14-22(2,3)18(16(17)13-19(20)23)11-8-12-28(25,26)15-9-6-5-7-10-15/h5-7,9-10,16,18H,4,8,11-14H2,1-3H3/t16-,18+/m0/s1 |
| InChIKey | XJPDANUWRTVSJC-FUHWJXTLSA-N |
| XLogP | 3.74 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|