C22H30O7S — CID 164668402
diethyl 3-[(4-acetylphenyl)methyl]-4-(methylsulfonylmethyl)cyclopentane-1,1-dicarboxylate (PubChem CID 164668402) has the molecular formula C22H30O7S and a molecular weight of 438.54 g/mol. Its IUPAC name is diethyl 3-[(4-acetylphenyl)methyl]-4-(methylsulfonylmethyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl 3-[(4-acetylphenyl)methyl]-4-(methylsulfonylmethyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 164668402 |
| Molecular Formula | C22H30O7S |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | diethyl 3-[(4-acetylphenyl)methyl]-4-(methylsulfonylmethyl)cyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC(Cc2ccc(C(C)=O)cc2)C(CS(C)(=O)=O)C1 |
| InChI | InChI=1S/C22H30O7S/c1-5-28-20(24)22(21(25)29-6-2)12-18(19(13-22)14-30(4,26)27)11-16-7-9-17(10-8-16)15(3)23/h7-10,18-19H,5-6,11-14H2,1-4H3 |
| InChIKey | AFEMLUCITKREAG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|