C24H28O6S — CID 18731154
tert-butyl 2-[(4-ethenylphenyl)methylsulfonyloxymethyl]-2-methyl-3-oxo-3-phenylpropanoate (PubChem CID 18731154) has the molecular formula C24H28O6S and a molecular weight of 444.55 g/mol. Its IUPAC name is tert-butyl 2-[(4-ethenylphenyl)methylsulfonyloxymethyl]-2-methyl-3-oxo-3-phenylpropanoate.
| Compound Name | tert-butyl 2-[(4-ethenylphenyl)methylsulfonyloxymethyl]-2-methyl-3-oxo-3-phenylpropanoate |
|---|---|
| PubChem CID | 18731154 |
| Molecular Formula | C24H28O6S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | tert-butyl 2-[(4-ethenylphenyl)methylsulfonyloxymethyl]-2-methyl-3-oxo-3-phenylpropanoate |
| SMILES | C=Cc1ccc(CS(=O)(=O)OCC(C)(C(=O)OC(C)(C)C)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H28O6S/c1-6-18-12-14-19(15-13-18)16-31(27,28)29-17-24(5,22(26)30-23(2,3)4)21(25)20-10-8-7-9-11-20/h6-15H,1,16-17H2,2-5H3 |
| InChIKey | XKNQVKCMFNBJAL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|