C18H16F2O5S — CID 70866354
[4-[2-(3,4-difluorophenyl)-3-ethoxy-3-oxopropanoyl]phenyl]methanesulfinic acid (PubChem CID 70866354) has the molecular formula C18H16F2O5S and a molecular weight of 382.38 g/mol. Its IUPAC name is [4-[2-(3,4-difluorophenyl)-3-ethoxy-3-oxopropanoyl]phenyl]methanesulfinic acid.
| Compound Name | [4-[2-(3,4-difluorophenyl)-3-ethoxy-3-oxopropanoyl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 70866354 |
| Molecular Formula | C18H16F2O5S |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | [4-[2-(3,4-difluorophenyl)-3-ethoxy-3-oxopropanoyl]phenyl]methanesulfinic acid |
| SMILES | CCOC(=O)C(C(=O)c1ccc(CS(=O)O)cc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H16F2O5S/c1-2-25-18(22)16(13-7-8-14(19)15(20)9-13)17(21)12-5-3-11(4-6-12)10-26(23)24/h3-9,16H,2,10H2,1H3,(H,23,24) |
| InChIKey | LRGOORHPGPYHCE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|