C34H54O11S — CID 158984412
tert-butyl 3-[4-oxo-4-[4-(16-oxo-1,4,7,10,13-pentaoxa-16λ4-thiacyclodocosane-18-carbonyl)phenyl]butoxy]propanoate (PubChem CID 158984412) has the molecular formula C34H54O11S and a molecular weight of 670.86 g/mol. Its IUPAC name is tert-butyl 3-[4-oxo-4-[4-(16-oxo-1,4,7,10,13-pentaoxa-16λ4-thiacyclodocosane-18-carbonyl)phenyl]butoxy]propanoate.
| Compound Name | tert-butyl 3-[4-oxo-4-[4-(16-oxo-1,4,7,10,13-pentaoxa-16λ4-thiacyclodocosane-18-carbonyl)phenyl]butoxy]propanoate |
|---|---|
| PubChem CID | 158984412 |
| Molecular Formula | C34H54O11S |
| Molecular Weight | 670.86 g/mol |
| Exact Mass | 670.34 |
| IUPAC Name | tert-butyl 3-[4-oxo-4-[4-(16-oxo-1,4,7,10,13-pentaoxa-16λ4-thiacyclodocosane-18-carbonyl)phenyl]butoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)CCOCCCC(=O)c1ccc(C(=O)C2CCCCOCCOCCOCCOCCOCCS(=O)C2)cc1 |
| InChI | InChI=1S/C34H54O11S/c1-34(2,3)45-32(36)13-16-39-15-6-8-31(35)28-9-11-29(12-10-28)33(37)30-7-4-5-14-40-17-18-41-19-20-42-21-22-43-23-24-44-25-26-46(38)27-30/h9-12,30H,4-8,13-27H2,1-3H3 |
| InChIKey | JPJYADGEFMIIOT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.86 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|