C32H51O5S+ — CID 59611893
[2-(4-cyclohexylphenyl)-2-oxoethyl]-bis(3-hexoxy-3-oxopropyl)sulfanium (PubChem CID 59611893) has the molecular formula C32H51O5S+ and a molecular weight of 547.82 g/mol. Its IUPAC name is [2-(4-cyclohexylphenyl)-2-oxoethyl]-bis(3-hexoxy-3-oxopropyl)sulfanium.
| Compound Name | [2-(4-cyclohexylphenyl)-2-oxoethyl]-bis(3-hexoxy-3-oxopropyl)sulfanium |
|---|---|
| PubChem CID | 59611893 |
| Molecular Formula | C32H51O5S+ |
| Molecular Weight | 547.82 g/mol |
| Exact Mass | 547.35 |
| IUPAC Name | [2-(4-cyclohexylphenyl)-2-oxoethyl]-bis(3-hexoxy-3-oxopropyl)sulfanium |
| SMILES | CCCCCCOC(=O)CC[S+](CCC(=O)OCCCCCC)CC(=O)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C32H51O5S/c1-3-5-7-12-22-36-31(34)20-24-38(25-21-32(35)37-23-13-8-6-4-2)26-30(33)29-18-16-28(17-19-29)27-14-10-9-11-15-27/h16-19,27H,3-15,20-26H2,1-2H3/q+1 |
| InChIKey | YMHDDWCQRUWODQ-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.82 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|