C23H32O3S — CID 12832533
hexyl 2-(11-oxo-6a,7,8,9,10,10a-hexahydro-6H-benzo[c][1]benzothiepin-3-yl)propanoate (PubChem CID 12832533) has the molecular formula C23H32O3S and a molecular weight of 388.57 g/mol. Its IUPAC name is hexyl 2-(11-oxo-6a,7,8,9,10,10a-hexahydro-6H-benzo[c][1]benzothiepin-3-yl)propanoate.
| Compound Name | hexyl 2-(11-oxo-6a,7,8,9,10,10a-hexahydro-6H-benzo[c][1]benzothiepin-3-yl)propanoate |
|---|---|
| PubChem CID | 12832533 |
| Molecular Formula | C23H32O3S |
| Molecular Weight | 388.57 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | hexyl 2-(11-oxo-6a,7,8,9,10,10a-hexahydro-6H-benzo[c][1]benzothiepin-3-yl)propanoate |
| SMILES | CCCCCCOC(=O)C(C)c1ccc2c(c1)SCC1CCCCC1C2=O |
| InChI | InChI=1S/C23H32O3S/c1-3-4-5-8-13-26-23(25)16(2)17-11-12-20-21(14-17)27-15-18-9-6-7-10-19(18)22(20)24/h11-12,14,16,18-19H,3-10,13,15H2,1-2H3 |
| InChIKey | SJMYHSUTWFNGMR-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.57 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|