C17H18O4S — CID 15473259
2-(benzenesulfonyl)-1-[(1R,2R,5R,6S)-1-methyl-9-oxatricyclo[4.2.1.02,5]non-7-en-2-yl]ethanone (PubChem CID 15473259) has the molecular formula C17H18O4S and a molecular weight of 318.39 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-1-[(1R,2R,5R,6S)-1-methyl-9-oxatricyclo[4.2.1.02,5]non-7-en-2-yl]ethanone.
| Compound Name | 2-(benzenesulfonyl)-1-[(1R,2R,5R,6S)-1-methyl-9-oxatricyclo[4.2.1.02,5]non-7-en-2-yl]ethanone |
|---|---|
| PubChem CID | 15473259 |
| Molecular Formula | C17H18O4S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 2-(benzenesulfonyl)-1-[(1R,2R,5R,6S)-1-methyl-9-oxatricyclo[4.2.1.02,5]non-7-en-2-yl]ethanone |
| SMILES | C[C@]12C=C[C@H](O1)[C@@H]1CC[C@@]12C(=O)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H18O4S/c1-16-9-8-14(21-16)13-7-10-17(13,16)15(18)11-22(19,20)12-5-3-2-4-6-12/h2-6,8-9,13-14H,7,10-11H2,1H3/t13-,14-,16+,17-/m0/s1 |
| InChIKey | XOWOLNPOOKWZMG-DIECFANBSA-N |
| XLogP | 2.15 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|