C16H16O4S — CID 15473258
2-(benzenesulfonyl)-1-[(1R,2R,5R,6S)-9-oxatricyclo[4.2.1.02,5]non-7-en-2-yl]ethanone (PubChem CID 15473258) has the molecular formula C16H16O4S and a molecular weight of 304.37 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-1-[(1R,2R,5R,6S)-9-oxatricyclo[4.2.1.02,5]non-7-en-2-yl]ethanone.
| Compound Name | 2-(benzenesulfonyl)-1-[(1R,2R,5R,6S)-9-oxatricyclo[4.2.1.02,5]non-7-en-2-yl]ethanone |
|---|---|
| PubChem CID | 15473258 |
| Molecular Formula | C16H16O4S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 2-(benzenesulfonyl)-1-[(1R,2R,5R,6S)-9-oxatricyclo[4.2.1.02,5]non-7-en-2-yl]ethanone |
| SMILES | O=C(CS(=O)(=O)c1ccccc1)[C@]12CC[C@H]1[C@@H]1C=C[C@H]2O1 |
| InChI | InChI=1S/C16H16O4S/c17-14(10-21(18,19)11-4-2-1-3-5-11)16-9-8-12(16)13-6-7-15(16)20-13/h1-7,12-13,15H,8-10H2/t12-,13-,15+,16-/m0/s1 |
| InChIKey | CZXSNGJIVQNZTN-UGQVUOCMSA-N |
| XLogP | 1.76 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|