C27H36O5S — CID 12000346
(1S,4E,9S,10R,14S)-7-(benzenesulfonyl)-12-methoxy-4-methyl-14-(4-methylpent-3-enyl)-11-oxatricyclo[7.5.0.010,14]tetradec-4-en-8-one (PubChem CID 12000346) has the molecular formula C27H36O5S and a molecular weight of 472.65 g/mol. Its IUPAC name is (1S,4E,9S,10R,14S)-7-(benzenesulfonyl)-12-methoxy-4-methyl-14-(4-methylpent-3-enyl)-11-oxatricyclo[7.5.0.010,14]tetradec-4-en-8-one.
| Compound Name | (1S,4E,9S,10R,14S)-7-(benzenesulfonyl)-12-methoxy-4-methyl-14-(4-methylpent-3-enyl)-11-oxatricyclo[7.5.0.010,14]tetradec-4-en-8-one |
|---|---|
| PubChem CID | 12000346 |
| Molecular Formula | C27H36O5S |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | (1S,4E,9S,10R,14S)-7-(benzenesulfonyl)-12-methoxy-4-methyl-14-(4-methylpent-3-enyl)-11-oxatricyclo[7.5.0.010,14]tetradec-4-en-8-one |
| SMILES | COC1C[C@]2(CCC=C(C)C)[C@H](O1)[C@H]1C(=O)C(S(=O)(=O)c3ccccc3)C/C=C(\C)CC[C@@H]12 |
| InChI | InChI=1S/C27H36O5S/c1-18(2)9-8-16-27-17-23(31-4)32-26(27)24-21(27)14-12-19(3)13-15-22(25(24)28)33(29,30)20-10-6-5-7-11-20/h5-7,9-11,13,21-24,26H,8,12,14-17H2,1-4H3/b19-13+/t21-,22?,23?,24+,26+,27-/m0/s1 |
| InChIKey | KDYAKTOPBSAVJW-KVKVPTEASA-N |
| XLogP | 5.27 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|