C22H32O5S — CID 164675972
(2S,3R,5S)-2-[4-(benzenesulfonylmethyl)pent-4-enyl]-3-(methoxymethoxy)-2,5-dimethylcyclohexan-1-one (PubChem CID 164675972) has the molecular formula C22H32O5S and a molecular weight of 408.56 g/mol. Its IUPAC name is (2S,3R,5S)-2-[4-(benzenesulfonylmethyl)pent-4-enyl]-3-(methoxymethoxy)-2,5-dimethylcyclohexan-1-one.
| Compound Name | (2S,3R,5S)-2-[4-(benzenesulfonylmethyl)pent-4-enyl]-3-(methoxymethoxy)-2,5-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 164675972 |
| Molecular Formula | C22H32O5S |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (2S,3R,5S)-2-[4-(benzenesulfonylmethyl)pent-4-enyl]-3-(methoxymethoxy)-2,5-dimethylcyclohexan-1-one |
| SMILES | C=C(CCC[C@]1(C)C(=O)C[C@@H](C)C[C@H]1OCOC)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H32O5S/c1-17(15-28(24,25)19-10-6-5-7-11-19)9-8-12-22(3)20(23)13-18(2)14-21(22)27-16-26-4/h5-7,10-11,18,21H,1,8-9,12-16H2,2-4H3/t18-,21-,22-/m1/s1 |
| InChIKey | ZDPYWJBQBDHMGD-STZQEDGTSA-N |
| XLogP | 4.18 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|