C23H32O5S — CID 11384633
4-(benzenesulfonyl)-5-[(9R)-6-methyl-9-prop-1-en-2-yl-1,4-dioxaspiro[4.5]decan-6-yl]pentan-2-one (PubChem CID 11384633) has the molecular formula C23H32O5S and a molecular weight of 420.57 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-5-[(9R)-6-methyl-9-prop-1-en-2-yl-1,4-dioxaspiro[4.5]decan-6-yl]pentan-2-one.
| Compound Name | 4-(benzenesulfonyl)-5-[(9R)-6-methyl-9-prop-1-en-2-yl-1,4-dioxaspiro[4.5]decan-6-yl]pentan-2-one |
|---|---|
| PubChem CID | 11384633 |
| Molecular Formula | C23H32O5S |
| Molecular Weight | 420.57 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 4-(benzenesulfonyl)-5-[(9R)-6-methyl-9-prop-1-en-2-yl-1,4-dioxaspiro[4.5]decan-6-yl]pentan-2-one |
| SMILES | C=C(C)[C@@H]1CCC(C)(CC(CC(C)=O)S(=O)(=O)c2ccccc2)C2(C1)OCCO2 |
| InChI | InChI=1S/C23H32O5S/c1-17(2)19-10-11-22(4,23(15-19)27-12-13-28-23)16-21(14-18(3)24)29(25,26)20-8-6-5-7-9-20/h5-9,19,21H,1,10-16H2,2-4H3/t19-,21?,22?/m1/s1 |
| InChIKey | XZJJPMKMRZLPBW-JSRJAPPDSA-N |
| XLogP | 4.32 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|