C24H32O3S — CID 134973489
(1S,2S,4aS,5S,8aR)-5-(methoxymethoxy)-1-methyl-2-[(E)-4-phenylsulfanylbut-2-en-2-yl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carbaldehyde (PubChem CID 134973489) has the molecular formula C24H32O3S and a molecular weight of 400.58 g/mol. Its IUPAC name is (1S,2S,4aS,5S,8aR)-5-(methoxymethoxy)-1-methyl-2-[(E)-4-phenylsulfanylbut-2-en-2-yl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carbaldehyde.
| Compound Name | (1S,2S,4aS,5S,8aR)-5-(methoxymethoxy)-1-methyl-2-[(E)-4-phenylsulfanylbut-2-en-2-yl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 134973489 |
| Molecular Formula | C24H32O3S |
| Molecular Weight | 400.58 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | (1S,2S,4aS,5S,8aR)-5-(methoxymethoxy)-1-methyl-2-[(E)-4-phenylsulfanylbut-2-en-2-yl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carbaldehyde |
| SMILES | COCO[C@H]1CCC[C@@H]2[C@@H]1C=C[C@@H](/C(C)=C/CSc1ccccc1)[C@@]2(C)C=O |
| InChI | InChI=1S/C24H32O3S/c1-18(14-15-28-19-8-5-4-6-9-19)21-13-12-20-22(24(21,2)16-25)10-7-11-23(20)27-17-26-3/h4-6,8-9,12-14,16,20-23H,7,10-11,15,17H2,1-3H3/b18-14+/t20-,21-,22+,23-,24+/m0/s1 |
| InChIKey | VJWGGMPNAIYLBG-DDSBVMTCSA-N |
| XLogP | 5.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.58 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|