C23H30O3S — CID 135050509
(4aS,5S)-4a-methyl-5-(oxan-2-yloxy)-1-(phenylsulfanylmethyl)-3,4,5,6,7,8-hexahydronaphthalen-2-one (PubChem CID 135050509) has the molecular formula C23H30O3S and a molecular weight of 386.56 g/mol. Its IUPAC name is (4aS,5S)-4a-methyl-5-(oxan-2-yloxy)-1-(phenylsulfanylmethyl)-3,4,5,6,7,8-hexahydronaphthalen-2-one.
| Compound Name | (4aS,5S)-4a-methyl-5-(oxan-2-yloxy)-1-(phenylsulfanylmethyl)-3,4,5,6,7,8-hexahydronaphthalen-2-one |
|---|---|
| PubChem CID | 135050509 |
| Molecular Formula | C23H30O3S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | (4aS,5S)-4a-methyl-5-(oxan-2-yloxy)-1-(phenylsulfanylmethyl)-3,4,5,6,7,8-hexahydronaphthalen-2-one |
| SMILES | C[C@]12CCC(=O)C(CSc3ccccc3)=C1CCC[C@@H]2OC1CCCCO1 |
| InChI | InChI=1S/C23H30O3S/c1-23-14-13-20(24)18(16-27-17-8-3-2-4-9-17)19(23)10-7-11-21(23)26-22-12-5-6-15-25-22/h2-4,8-9,21-22H,5-7,10-16H2,1H3/t21-,22?,23-/m0/s1 |
| InChIKey | AVNMNSDCIOUFPF-LIMDNCRJSA-N |
| XLogP | 5.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |