C21H26O4S — CID 135020244
(1S,8S,8aS)-8-(methoxymethoxy)-4,4,8a-trimethyl-1-phenylsulfanyl-1,6,7,8-tetrahydronaphthalene-2,3-dione (PubChem CID 135020244) has the molecular formula C21H26O4S and a molecular weight of 374.50 g/mol. Its IUPAC name is (1S,8S,8aS)-8-(methoxymethoxy)-4,4,8a-trimethyl-1-phenylsulfanyl-1,6,7,8-tetrahydronaphthalene-2,3-dione.
| Compound Name | (1S,8S,8aS)-8-(methoxymethoxy)-4,4,8a-trimethyl-1-phenylsulfanyl-1,6,7,8-tetrahydronaphthalene-2,3-dione |
|---|---|
| PubChem CID | 135020244 |
| Molecular Formula | C21H26O4S |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | (1S,8S,8aS)-8-(methoxymethoxy)-4,4,8a-trimethyl-1-phenylsulfanyl-1,6,7,8-tetrahydronaphthalene-2,3-dione |
| SMILES | COCO[C@H]1CCC=C2C(C)(C)C(=O)C(=O)[C@@H](Sc3ccccc3)[C@@]21C |
| InChI | InChI=1S/C21H26O4S/c1-20(2)15-11-8-12-16(25-13-24-4)21(15,3)19(17(22)18(20)23)26-14-9-6-5-7-10-14/h5-7,9-11,16,19H,8,12-13H2,1-4H3/t16-,19+,21-/m0/s1 |
| InChIKey | QCVQTRNUYBODLD-SCWSEQNSSA-N |
| XLogP | 4.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|