C23H30O3S — CID 10667898
(4'aR)-4'a,5,5-trimethyl-1'-(phenylsulfanylmethyl)spiro[1,3-dioxane-2,5'-4,6,7,8-tetrahydro-3H-naphthalene]-2'-one (PubChem CID 10667898) has the molecular formula C23H30O3S and a molecular weight of 386.56 g/mol. Its IUPAC name is (4'aR)-4'a,5,5-trimethyl-1'-(phenylsulfanylmethyl)spiro[1,3-dioxane-2,5'-4,6,7,8-tetrahydro-3H-naphthalene]-2'-one.
| Compound Name | (4'aR)-4'a,5,5-trimethyl-1'-(phenylsulfanylmethyl)spiro[1,3-dioxane-2,5'-4,6,7,8-tetrahydro-3H-naphthalene]-2'-one |
|---|---|
| PubChem CID | 10667898 |
| Molecular Formula | C23H30O3S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | (4'aR)-4'a,5,5-trimethyl-1'-(phenylsulfanylmethyl)spiro[1,3-dioxane-2,5'-4,6,7,8-tetrahydro-3H-naphthalene]-2'-one |
| SMILES | CC1(C)COC2(CCCC3=C(CSc4ccccc4)C(=O)CC[C@]32C)OC1 |
| InChI | InChI=1S/C23H30O3S/c1-21(2)15-25-23(26-16-21)12-7-10-19-18(20(24)11-13-22(19,23)3)14-27-17-8-5-4-6-9-17/h4-6,8-9H,7,10-16H2,1-3H3/t22-/m1/s1 |
| InChIKey | XSNAUAQXPDAQJD-JOCHJYFZSA-N |
| XLogP | 5.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |