C22H28O3S — CID 15929897
methyl 2-[(2R,4aR,5R)-4a,8-dimethyl-7-oxo-5-phenylsulfanyl-1,2,3,4,5,6-hexahydronaphthalen-2-yl]propanoate (PubChem CID 15929897) has the molecular formula C22H28O3S and a molecular weight of 372.53 g/mol. Its IUPAC name is methyl 2-[(2R,4aR,5R)-4a,8-dimethyl-7-oxo-5-phenylsulfanyl-1,2,3,4,5,6-hexahydronaphthalen-2-yl]propanoate.
| Compound Name | methyl 2-[(2R,4aR,5R)-4a,8-dimethyl-7-oxo-5-phenylsulfanyl-1,2,3,4,5,6-hexahydronaphthalen-2-yl]propanoate |
|---|---|
| PubChem CID | 15929897 |
| Molecular Formula | C22H28O3S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | methyl 2-[(2R,4aR,5R)-4a,8-dimethyl-7-oxo-5-phenylsulfanyl-1,2,3,4,5,6-hexahydronaphthalen-2-yl]propanoate |
| SMILES | COC(=O)C(C)[C@@H]1CC[C@]2(C)C(=C(C)C(=O)C[C@H]2Sc2ccccc2)C1 |
| InChI | InChI=1S/C22H28O3S/c1-14(21(24)25-4)16-10-11-22(3)18(12-16)15(2)19(23)13-20(22)26-17-8-6-5-7-9-17/h5-9,14,16,20H,10-13H2,1-4H3/t14?,16-,20-,22-/m1/s1 |
| InChIKey | IZQPJUSBCMIOGU-SKIBPDHRSA-N |
| XLogP | 5.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |