C21H30O2S — CID 10958948
(3S,4R,4aS,8aR)-3-(2,2-dimethylpropyl)-4-(phenylsulfanylmethyl)-3,4,4a,5,6,7,8,8a-octahydrochromen-2-one (PubChem CID 10958948) has the molecular formula C21H30O2S and a molecular weight of 346.54 g/mol. Its IUPAC name is (3S,4R,4aS,8aR)-3-(2,2-dimethylpropyl)-4-(phenylsulfanylmethyl)-3,4,4a,5,6,7,8,8a-octahydrochromen-2-one.
| Compound Name | (3S,4R,4aS,8aR)-3-(2,2-dimethylpropyl)-4-(phenylsulfanylmethyl)-3,4,4a,5,6,7,8,8a-octahydrochromen-2-one |
|---|---|
| PubChem CID | 10958948 |
| Molecular Formula | C21H30O2S |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | (3S,4R,4aS,8aR)-3-(2,2-dimethylpropyl)-4-(phenylsulfanylmethyl)-3,4,4a,5,6,7,8,8a-octahydrochromen-2-one |
| SMILES | CC(C)(C)C[C@@H]1C(=O)O[C@@H]2CCCC[C@H]2[C@H]1CSc1ccccc1 |
| InChI | InChI=1S/C21H30O2S/c1-21(2,3)13-17-18(14-24-15-9-5-4-6-10-15)16-11-7-8-12-19(16)23-20(17)22/h4-6,9-10,16-19H,7-8,11-14H2,1-3H3/t16-,17-,18+,19+/m0/s1 |
| InChIKey | UKOZRPLQDIYLFT-INDMIFKZSA-N |
| XLogP | 5.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |