C20H28O4S — CID 164673557
(2R,3S,5R)-2-[4-(benzenesulfonylmethyl)pent-4-enyl]-3-hydroxy-2,5-dimethylcyclohexan-1-one (PubChem CID 164673557) has the molecular formula C20H28O4S and a molecular weight of 364.51 g/mol. Its IUPAC name is (2R,3S,5R)-2-[4-(benzenesulfonylmethyl)pent-4-enyl]-3-hydroxy-2,5-dimethylcyclohexan-1-one.
| Compound Name | (2R,3S,5R)-2-[4-(benzenesulfonylmethyl)pent-4-enyl]-3-hydroxy-2,5-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 164673557 |
| Molecular Formula | C20H28O4S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | (2R,3S,5R)-2-[4-(benzenesulfonylmethyl)pent-4-enyl]-3-hydroxy-2,5-dimethylcyclohexan-1-one |
| SMILES | C=C(CCC[C@@]1(C)C(=O)C[C@H](C)C[C@@H]1O)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H28O4S/c1-15(14-25(23,24)17-9-5-4-6-10-17)8-7-11-20(3)18(21)12-16(2)13-19(20)22/h4-6,9-10,16,18,21H,1,7-8,11-14H2,2-3H3/t16-,18+,20-/m1/s1 |
| InChIKey | PITMMAXFBSWMKP-IMFGXOCKSA-N |
| XLogP | 3.55 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|