C14H18O4S — CID 134935869
2-(benzenesulfonyl)-1-cyclohexyl-2-hydroxyethanone (PubChem CID 134935869) has the molecular formula C14H18O4S and a molecular weight of 282.36 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-1-cyclohexyl-2-hydroxyethanone.
| Compound Name | 2-(benzenesulfonyl)-1-cyclohexyl-2-hydroxyethanone |
|---|---|
| PubChem CID | 134935869 |
| Molecular Formula | C14H18O4S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 2-(benzenesulfonyl)-1-cyclohexyl-2-hydroxyethanone |
| SMILES | O=C(C1CCCCC1)C(O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H18O4S/c15-13(11-7-3-1-4-8-11)14(16)19(17,18)12-9-5-2-6-10-12/h2,5-6,9-11,14,16H,1,3-4,7-8H2 |
| InChIKey | ZSWUSRJWMNZXAP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |